C25H31N3O4 — CID 92742866
N-(4-ethylphenyl)-2-[(4S)-1-(3-methoxyphenyl)-3-(3-methylbutyl)-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 92742866) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[(4S)-1-(3-methoxyphenyl)-3-(3-methylbutyl)-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[(4S)-1-(3-methoxyphenyl)-3-(3-methylbutyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 92742866 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-(4-ethylphenyl)-2-[(4S)-1-(3-methoxyphenyl)-3-(3-methylbutyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | CCc1ccc(NC(=O)C[C@H]2C(=O)N(c3cccc(OC)c3)C(=O)N2CCC(C)C)cc1 |
| InChI | InChI=1S/C25H31N3O4/c1-5-18-9-11-19(12-10-18)26-23(29)16-22-24(30)28(20-7-6-8-21(15-20)32-4)25(31)27(22)14-13-17(2)3/h6-12,15,17,22H,5,13-14,16H2,1-4H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | CKCIFUJIZTVVMO-QFIPXVFZSA-N |
| XLogP | 4.47 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|