C23H25N3O6 — CID 92742879
N-(3,5-dimethoxyphenyl)-2-[(4S)-1-(3-methoxyphenyl)-2,5-dioxo-3-prop-2-enylimidazolidin-4-yl]acetamide (PubChem CID 92742879) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-[(4S)-1-(3-methoxyphenyl)-2,5-dioxo-3-prop-2-enylimidazolidin-4-yl]acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-[(4S)-1-(3-methoxyphenyl)-2,5-dioxo-3-prop-2-enylimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 92742879 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-[(4S)-1-(3-methoxyphenyl)-2,5-dioxo-3-prop-2-enylimidazolidin-4-yl]acetamide |
| SMILES | C=CCN1C(=O)N(c2cccc(OC)c2)C(=O)[C@@H]1CC(=O)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C23H25N3O6/c1-5-9-25-20(14-21(27)24-15-10-18(31-3)13-19(11-15)32-4)22(28)26(23(25)29)16-7-6-8-17(12-16)30-2/h5-8,10-13,20H,1,9,14H2,2-4H3,(H,24,27)/t20-/m0/s1 |
| InChIKey | PHBVYGRILYEEBC-FQEVSTJZSA-N |
| XLogP | 3.06 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|