C16H13ClFN5OS — CID 9274422
(2S)-N-(3-chloro-4-fluorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 9274422) has the molecular formula C16H13ClFN5OS and a molecular weight of 377.83 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-fluorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(3-chloro-4-fluorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 9274422 |
| Molecular Formula | C16H13ClFN5OS |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | (2S)-N-(3-chloro-4-fluorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1nnnn1-c1ccccc1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H13ClFN5OS/c1-10(15(24)19-11-7-8-14(18)13(17)9-11)25-16-20-21-22-23(16)12-5-3-2-4-6-12/h2-10H,1H3,(H,19,24)/t10-/m0/s1 |
| InChIKey | HCRUEDVJGLMGEQ-JTQLQIEISA-N |
| XLogP | 3.57 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |