C27H37N5O4 — CID 92744304
(6R)-2-N-[(4-butoxyphenyl)methyl]-6-N-cyclopentyl-5-ethyl-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-2,6-dicarboxamide (PubChem CID 92744304) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is (6R)-2-N-[(4-butoxyphenyl)methyl]-6-N-cyclopentyl-5-ethyl-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-2,6-dicarboxamide.
| Compound Name | (6R)-2-N-[(4-butoxyphenyl)methyl]-6-N-cyclopentyl-5-ethyl-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 92744304 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | (6R)-2-N-[(4-butoxyphenyl)methyl]-6-N-cyclopentyl-5-ethyl-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-2,6-dicarboxamide |
| SMILES | CCCCOc1ccc(CNC(=O)c2cc3n(n2)C[C@](C)(C(=O)NC2CCCC2)N(CC)C3=O)cc1 |
| InChI | InChI=1S/C27H37N5O4/c1-4-6-15-36-21-13-11-19(12-14-21)17-28-24(33)22-16-23-25(34)31(5-2)27(3,18-32(23)30-22)26(35)29-20-9-7-8-10-20/h11-14,16,20H,4-10,15,17-18H2,1-3H3,(H,28,33)(H,29,35)/t27-/m1/s1 |
| InChIKey | QYVNFOWQWDLKPH-HHHXNRCGSA-N |
| XLogP | 3.29 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|