C20H21ClN2O4S — CID 92745687
7-[[(2R)-6-chloro-2-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 92745687) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is 7-[[(2R)-6-chloro-2-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[[(2R)-6-chloro-2-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 92745687 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 7-[[(2R)-6-chloro-2-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | CC[C@@H]1CN(S(=O)(=O)c2ccc3c(c2)CCCC(=O)N3)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C20H21ClN2O4S/c1-2-15-12-23(18-11-14(21)6-9-19(18)27-15)28(25,26)16-7-8-17-13(10-16)4-3-5-20(24)22-17/h6-11,15H,2-5,12H2,1H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | NPSBMECSBFMWEA-OAHLLOKOSA-N |
| XLogP | 3.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |