C17H18F2N2O — CID 9274676
(2S)-2-[benzyl(methyl)amino]-N-(2,6-difluorophenyl)propanamide (PubChem CID 9274676) has the molecular formula C17H18F2N2O and a molecular weight of 304.34 g/mol. Its IUPAC name is (2S)-2-[benzyl(methyl)amino]-N-(2,6-difluorophenyl)propanamide.
| Compound Name | (2S)-2-[benzyl(methyl)amino]-N-(2,6-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 9274676 |
| Molecular Formula | C17H18F2N2O |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (2S)-2-[benzyl(methyl)amino]-N-(2,6-difluorophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1c(F)cccc1F)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C17H18F2N2O/c1-12(21(2)11-13-7-4-3-5-8-13)17(22)20-16-14(18)9-6-10-15(16)19/h3-10,12H,11H2,1-2H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | GPIFLXPEALPMIF-LBPRGKRZSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |