C19H26ClN3O3 — CID 92746827
4-chloro-N-[[(2S)-oxolan-2-yl]methyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide (PubChem CID 92746827) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is 4-chloro-N-[[(2S)-oxolan-2-yl]methyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide.
| Compound Name | 4-chloro-N-[[(2S)-oxolan-2-yl]methyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 92746827 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 4-chloro-N-[[(2S)-oxolan-2-yl]methyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide |
| SMILES | O=C(CCN(C[C@@H]1CCCO1)C(=O)c1ccc(Cl)cc1)N1CCNCC1 |
| InChI | InChI=1S/C19H26ClN3O3/c20-16-5-3-15(4-6-16)19(25)23(14-17-2-1-13-26-17)10-7-18(24)22-11-8-21-9-12-22/h3-6,17,21H,1-2,7-14H2/t17-/m0/s1 |
| InChIKey | KAPYTMGWISKELC-KRWDZBQOSA-N |
| XLogP | 1.78 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |