C24H26FN3O3S — CID 92749297
(5S)-N-[(4-fluorophenyl)methyl]-4-(3-methoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide (PubChem CID 92749297) has the molecular formula C24H26FN3O3S and a molecular weight of 455.56 g/mol. Its IUPAC name is (5S)-N-[(4-fluorophenyl)methyl]-4-(3-methoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide.
| Compound Name | (5S)-N-[(4-fluorophenyl)methyl]-4-(3-methoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 92749297 |
| Molecular Formula | C24H26FN3O3S |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (5S)-N-[(4-fluorophenyl)methyl]-4-(3-methoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
| SMILES | COCCCN1C(=O)CSc2c(c3ccccc3n2C)[C@H]1C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H26FN3O3S/c1-27-19-7-4-3-6-18(19)21-22(23(30)26-14-16-8-10-17(25)11-9-16)28(12-5-13-31-2)20(29)15-32-24(21)27/h3-4,6-11,22H,5,12-15H2,1-2H3,(H,26,30)/t22-/m0/s1 |
| InChIKey | ZMITXPNMUNFEOH-QFIPXVFZSA-N |
| XLogP | 3.65 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|