C18H31N3O+2 — CID 9275209
(2R)-2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(2-methylpropyl)propanamide (PubChem CID 9275209) has the molecular formula C18H31N3O+2 and a molecular weight of 305.47 g/mol. Its IUPAC name is (2R)-2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(2-methylpropyl)propanamide.
| Compound Name | (2R)-2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 9275209 |
| Molecular Formula | C18H31N3O+2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (2R)-2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)[C@@H](C)[NH+]1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H29N3O/c1-15(2)13-19-18(22)16(3)21-11-9-20(10-12-21)14-17-7-5-4-6-8-17/h4-8,15-16H,9-14H2,1-3H3,(H,19,22)/p+2/t16-/m1/s1 |
| InChIKey | JUVDABKSOVLNIS-MRXNPFEDSA-P |
| XLogP | -0.87 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |