About (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol
(1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol (PubChem CID 92754326) has the molecular formula C15H20N4O
and a molecular weight of 272.35 g/mol. Its IUPAC name is (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol.
Molecular Properties
| Compound Name | (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol |
| PubChem CID | 92754326 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol |
| SMILES | O[C@](Cn1cncn1)(c1ccccn1)C1CCCCC1 |
| InChI | InChI=1S/C15H20N4O/c20-15(10-19-12-16-11-18-19,13-6-2-1-3-7-13)14-8-4-5-9-17-14/h4-5,8-9,11-13,20H,1-3,6-7,10H2/t15-/m0/s1 |
| InChIKey | JNRKEXAAGNCXDR-HNNXBMFYSA-N |
| XLogP | 2.14 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol?
The IUPAC name of (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol (CID 92754326) is (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol.
What is the SMILES notation for (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol?
The canonical SMILES for (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol is O[C@](Cn1cncn1)(c1ccccn1)C1CCCCC1.
What is the InChIKey of (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol?
The InChIKey is JNRKEXAAGNCXDR-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H20N4O/c20-15(10-19-12-16-11-18-19,13-6-2-1-3-7-13)14-8-4-5-9-17-14/h4-5,8-9,11-13,20H,1-3,6-7,10H2/t15-/m0/s1.
What are the key properties of (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol?
(1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol has a molecular weight of 272.35 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-cyclohexyl-1-pyridin-2-yl-2-(1,2,4-triazol-1-yl)ethanol is sourced from PubChem (CID 92754326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).