C27H34FN3O3 — CID 92761830
(3-fluoro-4-methoxyphenyl)-[4-[(2S)-2-prop-2-enoxy-2-(3-pyrrolidin-1-ylphenyl)ethyl]piperazin-1-yl]methanone (PubChem CID 92761830) has the molecular formula C27H34FN3O3 and a molecular weight of 467.59 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)-[4-[(2S)-2-prop-2-enoxy-2-(3-pyrrolidin-1-ylphenyl)ethyl]piperazin-1-yl]methanone.
| Compound Name | (3-fluoro-4-methoxyphenyl)-[4-[(2S)-2-prop-2-enoxy-2-(3-pyrrolidin-1-ylphenyl)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 92761830 |
| Molecular Formula | C27H34FN3O3 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)-[4-[(2S)-2-prop-2-enoxy-2-(3-pyrrolidin-1-ylphenyl)ethyl]piperazin-1-yl]methanone |
| SMILES | C=CCO[C@H](CN1CCN(C(=O)c2ccc(OC)c(F)c2)CC1)c1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C27H34FN3O3/c1-3-17-34-26(21-7-6-8-23(18-21)30-11-4-5-12-30)20-29-13-15-31(16-14-29)27(32)22-9-10-25(33-2)24(28)19-22/h3,6-10,18-19,26H,1,4-5,11-17,20H2,2H3/t26-/m1/s1 |
| InChIKey | XMEWVTKVNTVTSQ-AREMUKBSSA-N |
| XLogP | 4.14 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|