About 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one
9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one (PubChem CID 927642) has the molecular formula C16H10O5
and a molecular weight of 282.25 g/mol. Its IUPAC name is 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one.
Molecular Properties
| Compound Name | 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one |
| PubChem CID | 927642 |
| Molecular Formula | C16H10O5 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc3c(c(O)c12)OCO3 |
| InChI | InChI=1S/C16H10O5/c17-10-6-11(9-4-2-1-3-5-9)21-12-7-13-16(20-8-19-13)15(18)14(10)12/h1-7,18H,8H2 |
| InChIKey | NJIUXIXNVAHRDW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one?
The IUPAC name of 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one (CID 927642) is 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one.
What is the SMILES notation for 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one?
The canonical SMILES for 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one is O=c1cc(-c2ccccc2)oc2cc3c(c(O)c12)OCO3.
What is the InChIKey of 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one?
The InChIKey is NJIUXIXNVAHRDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O5/c17-10-6-11(9-4-2-1-3-5-9)21-12-7-13-16(20-8-19-13)15(18)14(10)12/h1-7,18H,8H2.
What are the key properties of 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one?
9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one has a molecular weight of 282.25 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-6-phenyl-[1,3]dioxolo[4,5-g]chromen-8-one is sourced from PubChem (CID 927642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).