C23H27N5O2S — CID 92764717
2-[4-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperazin-1-yl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 92764717) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-[4-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperazin-1-yl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[4-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperazin-1-yl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 92764717 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-[4-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperazin-1-yl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | O=C(CN1CCN(Cc2cc(=O)n3ccsc3n2)CC1)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C23H27N5O2S/c29-21(25-20-7-3-5-17-4-1-2-6-19(17)20)16-27-10-8-26(9-11-27)15-18-14-22(30)28-12-13-31-23(28)24-18/h1-2,4,6,12-14,20H,3,5,7-11,15-16H2,(H,25,29)/t20-/m1/s1 |
| InChIKey | WXYYDARZTMAVNP-HXUWFJFHSA-N |
| XLogP | 2.07 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |