C23H28F2N2O5S — CID 92767343
1-[4-(difluoromethoxy)phenyl]sulfonyl-4-[(2S)-2-(3-methoxyphenyl)-2-prop-2-enoxyethyl]piperazine (PubChem CID 92767343) has the molecular formula C23H28F2N2O5S and a molecular weight of 482.55 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]sulfonyl-4-[(2S)-2-(3-methoxyphenyl)-2-prop-2-enoxyethyl]piperazine.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]sulfonyl-4-[(2S)-2-(3-methoxyphenyl)-2-prop-2-enoxyethyl]piperazine |
|---|---|
| PubChem CID | 92767343 |
| Molecular Formula | C23H28F2N2O5S |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]sulfonyl-4-[(2S)-2-(3-methoxyphenyl)-2-prop-2-enoxyethyl]piperazine |
| SMILES | C=CCO[C@H](CN1CCN(S(=O)(=O)c2ccc(OC(F)F)cc2)CC1)c1cccc(OC)c1 |
| InChI | InChI=1S/C23H28F2N2O5S/c1-3-15-31-22(18-5-4-6-20(16-18)30-2)17-26-11-13-27(14-12-26)33(28,29)21-9-7-19(8-10-21)32-23(24)25/h3-10,16,22-23H,1,11-15,17H2,2H3/t22-/m1/s1 |
| InChIKey | XLPZLADVIANUPV-JOCHJYFZSA-N |
| XLogP | 3.55 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|