About [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol
[(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol (PubChem CID 927680) has the molecular formula C18H25NO2
and a molecular weight of 287.40 g/mol. Its IUPAC name is [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol.
Molecular Properties
| Compound Name | [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol |
| PubChem CID | 927680 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol |
| SMILES | CC1=CC[C@@]2(CO)CO[C@H](c3ccc(N(C)C)cc3)[C@@H]1C2 |
| InChI | InChI=1S/C18H25NO2/c1-13-8-9-18(11-20)10-16(13)17(21-12-18)14-4-6-15(7-5-14)19(2)3/h4-8,16-17,20H,9-12H2,1-3H3/t16-,17-,18-/m1/s1 |
| InChIKey | YIYYMQXKZZQRCR-KZNAEPCWSA-N |
| XLogP | 3.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol?
The IUPAC name of [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol (CID 927680) is [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol.
What is the SMILES notation for [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol?
The canonical SMILES for [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol is CC1=CC[C@@]2(CO)CO[C@H](c3ccc(N(C)C)cc3)[C@@H]1C2.
What is the InChIKey of [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol?
The InChIKey is YIYYMQXKZZQRCR-KZNAEPCWSA-N. The full InChI is InChI=1S/C18H25NO2/c1-13-8-9-18(11-20)10-16(13)17(21-12-18)14-4-6-15(7-5-14)19(2)3/h4-8,16-17,20H,9-12H2,1-3H3/t16-,17-,18-/m1/s1.
What are the key properties of [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol?
[(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol has a molecular weight of 287.40 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4S,5R)-4-[4-(dimethylamino)phenyl]-6-methyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol is sourced from PubChem (CID 927680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).