C28H32FN3O4 — CID 92772213
methyl (2R)-2-[3-[1-(4-acetamidophenyl)-5-(4-fluorophenyl)pyrrol-2-yl]propanoylamino]hexanoate (PubChem CID 92772213) has the molecular formula C28H32FN3O4 and a molecular weight of 493.58 g/mol. Its IUPAC name is methyl (2R)-2-[3-[1-(4-acetamidophenyl)-5-(4-fluorophenyl)pyrrol-2-yl]propanoylamino]hexanoate.
| Compound Name | methyl (2R)-2-[3-[1-(4-acetamidophenyl)-5-(4-fluorophenyl)pyrrol-2-yl]propanoylamino]hexanoate |
|---|---|
| PubChem CID | 92772213 |
| Molecular Formula | C28H32FN3O4 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | methyl (2R)-2-[3-[1-(4-acetamidophenyl)-5-(4-fluorophenyl)pyrrol-2-yl]propanoylamino]hexanoate |
| SMILES | CCCC[C@@H](NC(=O)CCc1ccc(-c2ccc(F)cc2)n1-c1ccc(NC(C)=O)cc1)C(=O)OC |
| InChI | InChI=1S/C28H32FN3O4/c1-4-5-6-25(28(35)36-3)31-27(34)18-16-24-15-17-26(20-7-9-21(29)10-8-20)32(24)23-13-11-22(12-14-23)30-19(2)33/h7-15,17,25H,4-6,16,18H2,1-3H3,(H,30,33)(H,31,34)/t25-/m1/s1 |
| InChIKey | LGRRSBBZOFSPKU-RUZDIDTESA-N |
| XLogP | 5.02 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|