C27H27N3O — CID 92772448
2-[(3R)-3-methylpiperidin-1-yl]-N-(naphthalen-1-ylmethyl)quinoline-4-carboxamide (PubChem CID 92772448) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[(3R)-3-methylpiperidin-1-yl]-N-(naphthalen-1-ylmethyl)quinoline-4-carboxamide.
| Compound Name | 2-[(3R)-3-methylpiperidin-1-yl]-N-(naphthalen-1-ylmethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 92772448 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 2-[(3R)-3-methylpiperidin-1-yl]-N-(naphthalen-1-ylmethyl)quinoline-4-carboxamide |
| SMILES | C[C@@H]1CCCN(c2cc(C(=O)NCc3cccc4ccccc34)c3ccccc3n2)C1 |
| InChI | InChI=1S/C27H27N3O/c1-19-8-7-15-30(18-19)26-16-24(23-13-4-5-14-25(23)29-26)27(31)28-17-21-11-6-10-20-9-2-3-12-22(20)21/h2-6,9-14,16,19H,7-8,15,17-18H2,1H3,(H,28,31)/t19-/m1/s1 |
| InChIKey | CBTXMGNRJCAYKU-LJQANCHMSA-N |
| XLogP | 5.55 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |