C20H16ClF2NO6 — CID 92775927
[(2S)-1-[3-chloro-4-(difluoromethoxy)anilino]-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 92775927) has the molecular formula C20H16ClF2NO6 and a molecular weight of 439.80 g/mol. Its IUPAC name is [(2S)-1-[3-chloro-4-(difluoromethoxy)anilino]-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [(2S)-1-[3-chloro-4-(difluoromethoxy)anilino]-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 92775927 |
| Molecular Formula | C20H16ClF2NO6 |
| Molecular Weight | 439.80 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | [(2S)-1-[3-chloro-4-(difluoromethoxy)anilino]-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc2c(c1)OCO2)C(=O)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C20H16ClF2NO6/c1-11(19(26)24-13-4-6-15(14(21)9-13)30-20(22)23)29-18(25)7-3-12-2-5-16-17(8-12)28-10-27-16/h2-9,11,20H,10H2,1H3,(H,24,26)/b7-3+/t11-/m0/s1 |
| InChIKey | DGZIUGAXAPXIGL-KTROKBFUSA-N |
| XLogP | 4.25 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.80 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|