About [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate
[(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate (PubChem CID 927760) has the molecular formula C9H15NO4S
and a molecular weight of 233.29 g/mol. Its IUPAC name is [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate.
Molecular Properties
| Compound Name | [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate |
| PubChem CID | 927760 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate |
| SMILES | CCOC(=O)N[C@H]1CSC[C@H]1OC(C)=O |
| InChI | InChI=1S/C9H15NO4S/c1-3-13-9(12)10-7-4-15-5-8(7)14-6(2)11/h7-8H,3-5H2,1-2H3,(H,10,12)/t7-,8+/m0/s1 |
| InChIKey | ZHGFTVVJUYRNOI-JGVFFNPUSA-N |
| XLogP | 0.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate?
The IUPAC name of [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate (CID 927760) is [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate.
What is the SMILES notation for [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate?
The canonical SMILES for [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate is CCOC(=O)N[C@H]1CSC[C@H]1OC(C)=O.
What is the InChIKey of [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate?
The InChIKey is ZHGFTVVJUYRNOI-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H15NO4S/c1-3-13-9(12)10-7-4-15-5-8(7)14-6(2)11/h7-8H,3-5H2,1-2H3,(H,10,12)/t7-,8+/m0/s1.
What are the key properties of [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate?
[(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate has a molecular weight of 233.29 g/mol, XLogP of 0.78, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-(ethoxycarbonylamino)thiolan-3-yl] acetate is sourced from PubChem (CID 927760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).