C26H28N3O2+ — CID 9280017
(2,4-dimethylphenyl)methyl-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]-methylazanium (PubChem CID 9280017) has the molecular formula C26H28N3O2+ and a molecular weight of 414.53 g/mol. Its IUPAC name is (2,4-dimethylphenyl)methyl-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]-methylazanium.
| Compound Name | (2,4-dimethylphenyl)methyl-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9280017 |
| Molecular Formula | C26H28N3O2+ |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (2,4-dimethylphenyl)methyl-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]-methylazanium |
| SMILES | Cc1ccc(C[NH+](C)CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C26H27N3O2/c1-19-14-15-21(20(2)16-19)17-28(3)18-29-24(30)26(27-25(29)31,22-10-6-4-7-11-22)23-12-8-5-9-13-23/h4-16H,17-18H2,1-3H3,(H,27,31)/p+1 |
| InChIKey | KAMBBILROHAKHV-UHFFFAOYSA-O |
| XLogP | 2.77 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|