C9H6Br2N2O4 — CID 92801215
(E,4E)-2,3-dibromo-4-(furan-2-carbonylhydrazinylidene)but-2-enoic acid (PubChem CID 92801215) has the molecular formula C9H6Br2N2O4 and a molecular weight of 365.97 g/mol. Its IUPAC name is (E,4E)-2,3-dibromo-4-(furan-2-carbonylhydrazinylidene)but-2-enoic acid.
| Compound Name | (E,4E)-2,3-dibromo-4-(furan-2-carbonylhydrazinylidene)but-2-enoic acid |
|---|---|
| PubChem CID | 92801215 |
| Molecular Formula | C9H6Br2N2O4 |
| Molecular Weight | 365.97 g/mol |
| Exact Mass | 363.87 |
| IUPAC Name | (E,4E)-2,3-dibromo-4-(furan-2-carbonylhydrazinylidene)but-2-enoic acid |
| SMILES | O=C(O)/C(Br)=C(Br)/C=N/NC(=O)c1ccco1 |
| InChI | InChI=1S/C9H6Br2N2O4/c10-5(7(11)9(15)16)4-12-13-8(14)6-2-1-3-17-6/h1-4H,(H,13,14)(H,15,16)/b7-5+,12-4+ |
| InChIKey | BKLDCFRXBXVYTO-HFTUHXIDSA-N |
| XLogP | 2.08 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.97 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|