C13H10N4O5S2 — CID 92801370
4-nitro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzenesulfonamide (PubChem CID 92801370) has the molecular formula C13H10N4O5S2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 4-nitro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzenesulfonamide.
| Compound Name | 4-nitro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 92801370 |
| Molecular Formula | C13H10N4O5S2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 4-nitro-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NCc2nc(-c3cccs3)no2)cc1 |
| InChI | InChI=1S/C13H10N4O5S2/c18-17(19)9-3-5-10(6-4-9)24(20,21)14-8-12-15-13(16-22-12)11-2-1-7-23-11/h1-7,14H,8H2 |
| InChIKey | VUYXGQGJKRDBOM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|