C23H19BrN2O — CID 92833268
(2S,5R,6R)-4-(4-bromophenyl)-2-(2-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene (PubChem CID 92833268) has the molecular formula C23H19BrN2O and a molecular weight of 419.32 g/mol. Its IUPAC name is (2S,5R,6R)-4-(4-bromophenyl)-2-(2-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene.
| Compound Name | (2S,5R,6R)-4-(4-bromophenyl)-2-(2-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 92833268 |
| Molecular Formula | C23H19BrN2O |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | (2S,5R,6R)-4-(4-bromophenyl)-2-(2-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
| SMILES | COc1ccccc1[C@@H]1N=C(c2ccc(Br)cc2)[C@H]2[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C23H19BrN2O/c1-27-19-10-6-5-9-18(19)23-25-20(15-11-13-17(24)14-12-15)22-21(26(22)23)16-7-3-2-4-8-16/h2-14,21-23H,1H3/t21-,22+,23-,26?/m1/s1 |
| InChIKey | IPKXJAZVJRQVSG-ZZOOTDKOSA-N |
| XLogP | 5.38 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|