C18H22O3 — CID 92835953
(3S,11R,13S,14S)-3,11-dihydroxy-13-methyl-2,3,4,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 92835953) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3S,11R,13S,14S)-3,11-dihydroxy-13-methyl-2,3,4,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,11R,13S,14S)-3,11-dihydroxy-13-methyl-2,3,4,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 92835953 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (3S,11R,13S,14S)-3,11-dihydroxy-13-methyl-2,3,4,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12C[C@@H](O)c3c(ccc4c3CC[C@H](O)C4)[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H22O3/c1-18-9-15(20)17-12-5-3-11(19)8-10(12)2-4-13(17)14(18)6-7-16(18)21/h2,4,11,14-15,19-20H,3,5-9H2,1H3/t11-,14-,15+,18-/m0/s1 |
| InChIKey | MQYQFUUOVBWVKJ-MKXCTONWSA-N |
| XLogP | 2.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |