C20H13BrCl2N2O2S — CID 92836264
2-[(5S,10bS)-9-bromo-2-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4,6-dichlorophenol (PubChem CID 92836264) has the molecular formula C20H13BrCl2N2O2S and a molecular weight of 496.21 g/mol. Its IUPAC name is 2-[(5S,10bS)-9-bromo-2-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4,6-dichlorophenol.
| Compound Name | 2-[(5S,10bS)-9-bromo-2-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 92836264 |
| Molecular Formula | C20H13BrCl2N2O2S |
| Molecular Weight | 496.21 g/mol |
| Exact Mass | 493.93 |
| IUPAC Name | 2-[(5S,10bS)-9-bromo-2-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4,6-dichlorophenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1[C@@H]1Oc2ccc(Br)cc2[C@@H]2CC(c3cccs3)=NN21 |
| InChI | InChI=1S/C20H13BrCl2N2O2S/c21-10-3-4-17-12(6-10)16-9-15(18-2-1-5-28-18)24-25(16)20(27-17)13-7-11(22)8-14(23)19(13)26/h1-8,16,20,26H,9H2/t16-,20-/m0/s1 |
| InChIKey | IEDFKTDQDQWIOB-JXFKEZNVSA-N |
| XLogP | 6.77 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.21 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|