C23H18BrClN2O3 — CID 92837075
2-[(5R,10bS)-9-chloro-2-(4-methoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4-bromophenol (PubChem CID 92837075) has the molecular formula C23H18BrClN2O3 and a molecular weight of 485.77 g/mol. Its IUPAC name is 2-[(5R,10bS)-9-chloro-2-(4-methoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4-bromophenol.
| Compound Name | 2-[(5R,10bS)-9-chloro-2-(4-methoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4-bromophenol |
|---|---|
| PubChem CID | 92837075 |
| Molecular Formula | C23H18BrClN2O3 |
| Molecular Weight | 485.77 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | 2-[(5R,10bS)-9-chloro-2-(4-methoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4-bromophenol |
| SMILES | COc1ccc(C2=NN3[C@@H](c4cc(Br)ccc4O)Oc4ccc(Cl)cc4[C@@H]3C2)cc1 |
| InChI | InChI=1S/C23H18BrClN2O3/c1-29-16-6-2-13(3-7-16)19-12-20-17-11-15(25)5-9-22(17)30-23(27(20)26-19)18-10-14(24)4-8-21(18)28/h2-11,20,23,28H,12H2,1H3/t20-,23+/m0/s1 |
| InChIKey | UIYHQXLOTCBVOF-NZQKXSOJSA-N |
| XLogP | 6.06 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.77 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|