C9H14N6O4 — CID 92840367
(3aS,5R,6R,7R,7aS)-6-azido-5-(azidomethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-7-ol (PubChem CID 92840367) has the molecular formula C9H14N6O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is (3aS,5R,6R,7R,7aS)-6-azido-5-(azidomethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-7-ol.
| Compound Name | (3aS,5R,6R,7R,7aS)-6-azido-5-(azidomethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-7-ol |
|---|---|
| PubChem CID | 92840367 |
| Molecular Formula | C9H14N6O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (3aS,5R,6R,7R,7aS)-6-azido-5-(azidomethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-7-ol |
| SMILES | CC1(C)O[C@@H]2O[C@H](CN=[N+]=[N-])[C@H](N=[N+]=[N-])[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C9H14N6O4/c1-9(2)18-7-6(16)5(13-15-11)4(3-12-14-10)17-8(7)19-9/h4-8,16H,3H2,1-2H3/t4-,5+,6-,7+,8+/m1/s1 |
| InChIKey | XAHDPGKUFJTQSN-OMKQZNDVSA-N |
| XLogP | 1.21 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|