About dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium
dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium (PubChem CID 9284108) has the molecular formula C16H28N3O3S+
and a molecular weight of 342.49 g/mol. Its IUPAC name is dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium.
Molecular Properties
| Compound Name | dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium |
| PubChem CID | 9284108 |
| Molecular Formula | C16H28N3O3S+ |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium |
| SMILES | COc1cc(CNC(=S)NCCC[NH+](C)C)cc(OC)c1OC |
| InChI | InChI=1S/C16H27N3O3S/c1-19(2)8-6-7-17-16(23)18-11-12-9-13(20-3)15(22-5)14(10-12)21-4/h9-10H,6-8,11H2,1-5H3,(H2,17,18,23)/p+1 |
| InChIKey | SWLLIEOZIVFEGG-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium?
The IUPAC name of dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium (CID 9284108) is dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium.
What is the SMILES notation for dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium?
The canonical SMILES for dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium is COc1cc(CNC(=S)NCCC[NH+](C)C)cc(OC)c1OC.
What is the InChIKey of dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium?
The InChIKey is SWLLIEOZIVFEGG-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H27N3O3S/c1-19(2)8-6-7-17-16(23)18-11-12-9-13(20-3)15(22-5)14(10-12)21-4/h9-10H,6-8,11H2,1-5H3,(H2,17,18,23)/p+1.
What are the key properties of dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium?
dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium has a molecular weight of 342.49 g/mol, XLogP of 0.21, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[3-[(3,4,5-trimethoxyphenyl)methylcarbamothioylamino]propyl]azanium is sourced from PubChem (CID 9284108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).