C10H15NO — CID 92843715
(3aR,9aR)-3-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,2]oxazole (PubChem CID 92843715) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3aR,9aR)-3-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,2]oxazole.
| Compound Name | (3aR,9aR)-3-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,2]oxazole |
|---|---|
| PubChem CID | 92843715 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3aR,9aR)-3-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,2]oxazole |
| SMILES | CC1=NO[C@@H]2CCC=CCC[C@H]12 |
| InChI | InChI=1S/C10H15NO/c1-8-9-6-4-2-3-5-7-10(9)12-11-8/h2-3,9-10H,4-7H2,1H3/t9-,10-/m1/s1 |
| InChIKey | WNDBIHKXFOBPPC-NXEZZACHSA-N |
| XLogP | 2.51 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|