C20H20N2O2 — CID 92844023
5-[(2R,4aR)-7-(5-formyl-1H-pyrrol-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-2-yl]-1H-pyrrole-2-carbaldehyde (PubChem CID 92844023) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-[(2R,4aR)-7-(5-formyl-1H-pyrrol-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-2-yl]-1H-pyrrole-2-carbaldehyde.
| Compound Name | 5-[(2R,4aR)-7-(5-formyl-1H-pyrrol-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-2-yl]-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 92844023 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 5-[(2R,4aR)-7-(5-formyl-1H-pyrrol-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-2-yl]-1H-pyrrole-2-carbaldehyde |
| SMILES | O=Cc1ccc(C2=CC3=C[C@H](c4ccc(C=O)[nH]4)CC[C@@H]3CC2)[nH]1 |
| InChI | InChI=1S/C20H20N2O2/c23-11-17-5-7-19(21-17)14-3-1-13-2-4-15(10-16(13)9-14)20-8-6-18(12-24)22-20/h5-14,21-22H,1-4H2/t13-,14-/m1/s1 |
| InChIKey | GLYNAPMHXIUNBZ-ZIAGYGMSSA-N |
| XLogP | 4.27 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|