C24H23N3 — CID 92844224
4-[(2S,5S,6R)-4,6-diphenyl-1,3-diazabicyclo[3.1.0]hex-3-en-2-yl]-N,N-dimethylaniline (PubChem CID 92844224) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-[(2S,5S,6R)-4,6-diphenyl-1,3-diazabicyclo[3.1.0]hex-3-en-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(2S,5S,6R)-4,6-diphenyl-1,3-diazabicyclo[3.1.0]hex-3-en-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 92844224 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 4-[(2S,5S,6R)-4,6-diphenyl-1,3-diazabicyclo[3.1.0]hex-3-en-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@@H]2N=C(c3ccccc3)[C@@H]3[C@@H](c4ccccc4)N32)cc1 |
| InChI | InChI=1S/C24H23N3/c1-26(2)20-15-13-19(14-16-20)24-25-21(17-9-5-3-6-10-17)23-22(27(23)24)18-11-7-4-8-12-18/h3-16,22-24H,1-2H3/t22-,23-,24-,27?/m1/s1 |
| InChIKey | RSXWXEAYFFVBFX-WOOZGKCQSA-N |
| XLogP | 4.68 |
| TPSA | 18.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|