C17H24N4OS — CID 92846194
7-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 92846194) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 7-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 92846194 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 7-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCc1nn2c(=O)cc(CN3CC[C@H]4CCCC[C@@H]4C3)nc2s1 |
| InChI | InChI=1S/C17H24N4OS/c1-2-15-19-21-16(22)9-14(18-17(21)23-15)11-20-8-7-12-5-3-4-6-13(12)10-20/h9,12-13H,2-8,10-11H2,1H3/t12-,13-/m1/s1 |
| InChIKey | ZBEZTTKOQAXSTE-CHWSQXEVSA-N |
| XLogP | 2.73 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |