C16H12N4OS — CID 92846522
(8S,8aS)-6-amino-8-thiophen-3-yl-1,3,8,8a-tetrahydroisochromene-5,7,7-tricarbonitrile (PubChem CID 92846522) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is (8S,8aS)-6-amino-8-thiophen-3-yl-1,3,8,8a-tetrahydroisochromene-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aS)-6-amino-8-thiophen-3-yl-1,3,8,8a-tetrahydroisochromene-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 92846522 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (8S,8aS)-6-amino-8-thiophen-3-yl-1,3,8,8a-tetrahydroisochromene-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@@H](c2ccsc2)[C@@H]2COCC=C12 |
| InChI | InChI=1S/C16H12N4OS/c17-5-12-11-1-3-21-6-13(11)14(10-2-4-22-7-10)16(8-18,9-19)15(12)20/h1-2,4,7,13-14H,3,6,20H2/t13-,14+/m1/s1 |
| InChIKey | DKODWWWXNVZULB-KGLIPLIRSA-N |
| XLogP | 2.19 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|