C26H24N4O2S — CID 92846815
N-[(E)-(3-methyl-5-oxo-1,2-diphenylpyrazol-4-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 92846815) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-[(E)-(3-methyl-5-oxo-1,2-diphenylpyrazol-4-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(E)-(3-methyl-5-oxo-1,2-diphenylpyrazol-4-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 92846815 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | N-[(E)-(3-methyl-5-oxo-1,2-diphenylpyrazol-4-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1c(/C=N/NC(=O)c2csc3c2CCCC3)c(=O)n(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H24N4O2S/c1-18-22(16-27-28-25(31)23-17-33-24-15-9-8-14-21(23)24)26(32)30(20-12-6-3-7-13-20)29(18)19-10-4-2-5-11-19/h2-7,10-13,16-17H,8-9,14-15H2,1H3,(H,28,31)/b27-16+ |
| InChIKey | ZOIHORYYOXIAMO-JVWAILMASA-N |
| XLogP | 4.64 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|