About 5-methylphenazin-5-ium;methyl sulfate
5-methylphenazin-5-ium;methyl sulfate (PubChem CID 9285) has the molecular formula C14H14N2O4S
and a molecular weight of 306.34 g/mol. Its IUPAC name is 5-methylphenazin-5-ium;methyl sulfate.
Molecular Properties
| Compound Name | 5-methylphenazin-5-ium;methyl sulfate |
| PubChem CID | 9285 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 5-methylphenazin-5-ium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[n+]1c2ccccc2nc2ccccc21 |
| InChI | InChI=1S/C13H11N2.CH4O4S/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)15;1-5-6(2,3)4/h2-9H,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 83.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 5-methylphenazin-5-ium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylphenazin-5-ium;methyl sulfate?
The IUPAC name of 5-methylphenazin-5-ium;methyl sulfate (CID 9285) is 5-methylphenazin-5-ium;methyl sulfate.
What is the SMILES notation for 5-methylphenazin-5-ium;methyl sulfate?
The canonical SMILES for 5-methylphenazin-5-ium;methyl sulfate is COS(=O)(=O)[O-].C[n+]1c2ccccc2nc2ccccc21.
What is the InChIKey of 5-methylphenazin-5-ium;methyl sulfate?
The InChIKey is RXGJTUSBYWCRBK-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H11N2.CH4O4S/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)15;1-5-6(2,3)4/h2-9H,1H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of 5-methylphenazin-5-ium;methyl sulfate?
5-methylphenazin-5-ium;methyl sulfate has a molecular weight of 306.34 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylphenazin-5-ium;methyl sulfate is sourced from PubChem (CID 9285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).