About (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one
(11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one (PubChem CID 92852371) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one.
Molecular Properties
| Compound Name | (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one |
| PubChem CID | 92852371 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one |
| SMILES | O=C1Nc2ccccc2[C@H](O)c2ccccc21 |
| InChI | InChI=1S/C14H11NO2/c16-13-9-5-1-2-6-10(9)14(17)15-12-8-4-3-7-11(12)13/h1-8,13,16H,(H,15,17)/t13-/m1/s1 |
| InChIKey | MVDLFUHQOPGQGH-CYBMUJFWSA-N |
| XLogP | 2.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one?
The IUPAC name of (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one (CID 92852371) is (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one.
What is the SMILES notation for (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one?
The canonical SMILES for (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one is O=C1Nc2ccccc2[C@H](O)c2ccccc21.
What is the InChIKey of (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one?
The InChIKey is MVDLFUHQOPGQGH-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H11NO2/c16-13-9-5-1-2-6-10(9)14(17)15-12-8-4-3-7-11(12)13/h1-8,13,16H,(H,15,17)/t13-/m1/s1.
What are the key properties of (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one?
(11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one has a molecular weight of 225.25 g/mol, XLogP of 2.33, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one is sourced from PubChem (CID 92852371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).