C14H11NO2 — CID 92852371
(11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one (PubChem CID 92852371) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one.
| Compound Name | (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one |
|---|---|
| PubChem CID | 92852371 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (11R)-11-hydroxy-5,11-dihydrobenzo[c][1]benzazepin-6-one |
| SMILES | O=C1Nc2ccccc2[C@H](O)c2ccccc21 |
| InChI | InChI=1S/C14H11NO2/c16-13-9-5-1-2-6-10(9)14(17)15-12-8-4-3-7-11(12)13/h1-8,13,16H,(H,15,17)/t13-/m1/s1 |
| InChIKey | MVDLFUHQOPGQGH-CYBMUJFWSA-N |
| XLogP | 2.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |