C24H46O2 — CID 92854568
(10S,13S)-10,13-dimethyldocos-11-yne-10,13-diol (PubChem CID 92854568) has the molecular formula C24H46O2 and a molecular weight of 366.63 g/mol. Its IUPAC name is (10S,13S)-10,13-dimethyldocos-11-yne-10,13-diol.
| Compound Name | (10S,13S)-10,13-dimethyldocos-11-yne-10,13-diol |
|---|---|
| PubChem CID | 92854568 |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.35 |
| IUPAC Name | (10S,13S)-10,13-dimethyldocos-11-yne-10,13-diol |
| SMILES | CCCCCCCCC[C@](C)(O)C#C[C@@](C)(O)CCCCCCCCC |
| InChI | InChI=1S/C24H46O2/c1-5-7-9-11-13-15-17-19-23(3,25)21-22-24(4,26)20-18-16-14-12-10-8-6-2/h25-26H,5-20H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | SVJREAUWQPERAY-ZEQRLZLVSA-N |
| XLogP | 6.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|