C15H17NO2 — CID 928551
(3S,5R)-5-methyl-3-[(2-methyl-1H-indol-3-yl)methyl]oxolan-2-one (PubChem CID 928551) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (3S,5R)-5-methyl-3-[(2-methyl-1H-indol-3-yl)methyl]oxolan-2-one.
| Compound Name | (3S,5R)-5-methyl-3-[(2-methyl-1H-indol-3-yl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 928551 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (3S,5R)-5-methyl-3-[(2-methyl-1H-indol-3-yl)methyl]oxolan-2-one |
| SMILES | Cc1[nH]c2ccccc2c1C[C@H]1C[C@@H](C)OC1=O |
| InChI | InChI=1S/C15H17NO2/c1-9-7-11(15(17)18-9)8-13-10(2)16-14-6-4-3-5-12(13)14/h3-6,9,11,16H,7-8H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | LBCSSFHBUUXFJE-MWLCHTKSSA-N |
| XLogP | 2.97 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|