About (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine
(4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine (PubChem CID 92855630) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine.
Molecular Properties
| Compound Name | (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine |
| PubChem CID | 92855630 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine |
| SMILES | C=CC[C@H]1c2ccoc2C=CN1C |
| InChI | InChI=1S/C11H13NO/c1-3-4-10-9-6-8-13-11(9)5-7-12(10)2/h3,5-8,10H,1,4H2,2H3/t10-/m0/s1 |
| InChIKey | NTZGZIROQDINCK-JTQLQIEISA-N |
| XLogP | 2.81 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine?
The IUPAC name of (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine (CID 92855630) is (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine.
What is the SMILES notation for (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine?
The canonical SMILES for (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine is C=CC[C@H]1c2ccoc2C=CN1C.
What is the InChIKey of (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine?
The InChIKey is NTZGZIROQDINCK-JTQLQIEISA-N. The full InChI is InChI=1S/C11H13NO/c1-3-4-10-9-6-8-13-11(9)5-7-12(10)2/h3,5-8,10H,1,4H2,2H3/t10-/m0/s1.
What are the key properties of (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine?
(4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine has a molecular weight of 175.23 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5-methyl-4-prop-2-enyl-4H-furo[3,2-c]pyridine is sourced from PubChem (CID 92855630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).