C22H31N5O3 — CID 92855739
(3aS,7aS)-2-[2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 92855739) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is (3aS,7aS)-2-[2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 92855739 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | (3aS,7aS)-2-[2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1cc(N2CCN(C(=O)CN3C(=O)[C@H]4CCCC[C@@H]4C3=O)CC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C22H31N5O3/c1-14(2)20-23-15(3)12-18(24-20)25-8-10-26(11-9-25)19(28)13-27-21(29)16-6-4-5-7-17(16)22(27)30/h12,14,16-17H,4-11,13H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | REPWLOHVRPPWDU-IRXDYDNUSA-N |
| XLogP | 1.73 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|