About 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine
4-[(1S,2R)-2-phenoxycyclohexyl]morpholine (PubChem CID 92857072) has the molecular formula C16H23NO2
and a molecular weight of 261.36 g/mol. Its IUPAC name is 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine.
Molecular Properties
| Compound Name | 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine |
| PubChem CID | 92857072 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine |
| SMILES | c1ccc(O[C@@H]2CCCC[C@@H]2N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H23NO2/c1-2-6-14(7-3-1)19-16-9-5-4-8-15(16)17-10-12-18-13-11-17/h1-3,6-7,15-16H,4-5,8-13H2/t15-,16+/m0/s1 |
| InChIKey | DVPJJTVPVSGTRA-JKSUJKDBSA-N |
| XLogP | 2.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine?
The IUPAC name of 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine (CID 92857072) is 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine.
What is the SMILES notation for 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine?
The canonical SMILES for 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine is c1ccc(O[C@@H]2CCCC[C@@H]2N2CCOCC2)cc1.
What is the InChIKey of 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine?
The InChIKey is DVPJJTVPVSGTRA-JKSUJKDBSA-N. The full InChI is InChI=1S/C16H23NO2/c1-2-6-14(7-3-1)19-16-9-5-4-8-15(16)17-10-12-18-13-11-17/h1-3,6-7,15-16H,4-5,8-13H2/t15-,16+/m0/s1.
What are the key properties of 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine?
4-[(1S,2R)-2-phenoxycyclohexyl]morpholine has a molecular weight of 261.36 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,2R)-2-phenoxycyclohexyl]morpholine is sourced from PubChem (CID 92857072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).