C10H17NO4S — CID 92857204
(4S)-5,6-dimethyl-4-morpholin-4-yl-3,4-dihydrooxathiine 2,2-dioxide (PubChem CID 92857204) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is (4S)-5,6-dimethyl-4-morpholin-4-yl-3,4-dihydrooxathiine 2,2-dioxide.
| Compound Name | (4S)-5,6-dimethyl-4-morpholin-4-yl-3,4-dihydrooxathiine 2,2-dioxide |
|---|---|
| PubChem CID | 92857204 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (4S)-5,6-dimethyl-4-morpholin-4-yl-3,4-dihydrooxathiine 2,2-dioxide |
| SMILES | CC1=C(C)[C@H](N2CCOCC2)CS(=O)(=O)O1 |
| InChI | InChI=1S/C10H17NO4S/c1-8-9(2)15-16(12,13)7-10(8)11-3-5-14-6-4-11/h10H,3-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | VUISNAZBZKLQAD-SNVBAGLBSA-N |
| XLogP | 0.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|