C14H22N2O4 — CID 92857454
trans-(2S,5S)-2,5-dimorpholin-4-ylcyclohexane-1,4-dione (PubChem CID 92857454) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is trans-(2S,5S)-2,5-dimorpholin-4-ylcyclohexane-1,4-dione.
| Compound Name | trans-(2S,5S)-2,5-dimorpholin-4-ylcyclohexane-1,4-dione |
|---|---|
| PubChem CID | 92857454 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | trans-(2S,5S)-2,5-dimorpholin-4-ylcyclohexane-1,4-dione |
| SMILES | O=C1C[C@H](N2CCOCC2)C(=O)C[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C14H22N2O4/c17-13-10-12(16-3-7-20-8-4-16)14(18)9-11(13)15-1-5-19-6-2-15/h11-12H,1-10H2/t11-,12-/m0/s1 |
| InChIKey | SLTSBSGSKGDHQC-RYUDHWBXSA-N |
| XLogP | -0.68 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |