C10H18BrNO — CID 92857917
(3S)-3-bromo-1,2,2,6,6-pentamethylpiperidin-4-one (PubChem CID 92857917) has the molecular formula C10H18BrNO and a molecular weight of 248.16 g/mol. Its IUPAC name is (3S)-3-bromo-1,2,2,6,6-pentamethylpiperidin-4-one.
| Compound Name | (3S)-3-bromo-1,2,2,6,6-pentamethylpiperidin-4-one |
|---|---|
| PubChem CID | 92857917 |
| Molecular Formula | C10H18BrNO |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (3S)-3-bromo-1,2,2,6,6-pentamethylpiperidin-4-one |
| SMILES | CN1C(C)(C)CC(=O)[C@@H](Br)C1(C)C |
| InChI | InChI=1S/C10H18BrNO/c1-9(2)6-7(13)8(11)10(3,4)12(9)5/h8H,6H2,1-5H3/t8-/m1/s1 |
| InChIKey | RCNCVWBGGCFCNE-MRVPVSSYSA-N |
| XLogP | 2.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|