C27H32O7 — CID 92858091
(2E,3R,6Z)-3-methyl-2,6-bis[(3,4,5-trimethoxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 92858091) has the molecular formula C27H32O7 and a molecular weight of 468.55 g/mol. Its IUPAC name is (2E,3R,6Z)-3-methyl-2,6-bis[(3,4,5-trimethoxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,3R,6Z)-3-methyl-2,6-bis[(3,4,5-trimethoxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 92858091 |
| Molecular Formula | C27H32O7 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (2E,3R,6Z)-3-methyl-2,6-bis[(3,4,5-trimethoxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C2/CC[C@@H](C)/C(=C\c3cc(OC)c(OC)c(OC)c3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C27H32O7/c1-16-8-9-19(10-17-12-21(29-2)26(33-6)22(13-17)30-3)25(28)20(16)11-18-14-23(31-4)27(34-7)24(15-18)32-5/h10-16H,8-9H2,1-7H3/b19-10-,20-11+/t16-/m1/s1 |
| InChIKey | NISOQKGHYYAZDL-VCUSOXRVSA-N |
| XLogP | 5.20 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|