C25H28O5 — CID 92858095
(2Z,3R,6E)-2,6-bis[(3,4-dimethoxyphenyl)methylidene]-3-methylcyclohexan-1-one (PubChem CID 92858095) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is (2Z,3R,6E)-2,6-bis[(3,4-dimethoxyphenyl)methylidene]-3-methylcyclohexan-1-one.
| Compound Name | (2Z,3R,6E)-2,6-bis[(3,4-dimethoxyphenyl)methylidene]-3-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 92858095 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (2Z,3R,6E)-2,6-bis[(3,4-dimethoxyphenyl)methylidene]-3-methylcyclohexan-1-one |
| SMILES | COc1ccc(/C=C2\C(=O)/C(=C/c3ccc(OC)c(OC)c3)CC[C@H]2C)cc1OC |
| InChI | InChI=1S/C25H28O5/c1-16-6-9-19(12-17-7-10-21(27-2)23(14-17)29-4)25(26)20(16)13-18-8-11-22(28-3)24(15-18)30-5/h7-8,10-16H,6,9H2,1-5H3/b19-12+,20-13-/t16-/m1/s1 |
| InChIKey | FNEHNMVDEJMKOR-DBGZARRSSA-N |
| XLogP | 5.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|