C19H24N4 — CID 92858211
4-[3-[[butyl(methyl)amino]methyl]imidazo[1,2-a]pyridin-2-yl]aniline (PubChem CID 92858211) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is 4-[3-[[butyl(methyl)amino]methyl]imidazo[1,2-a]pyridin-2-yl]aniline.
| Compound Name | 4-[3-[[butyl(methyl)amino]methyl]imidazo[1,2-a]pyridin-2-yl]aniline |
|---|---|
| PubChem CID | 92858211 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 4-[3-[[butyl(methyl)amino]methyl]imidazo[1,2-a]pyridin-2-yl]aniline |
| SMILES | CCCCN(C)Cc1c(-c2ccc(N)cc2)nc2ccccn12 |
| InChI | InChI=1S/C19H24N4/c1-3-4-12-22(2)14-17-19(15-8-10-16(20)11-9-15)21-18-7-5-6-13-23(17)18/h5-11,13H,3-4,12,14,20H2,1-2H3 |
| InChIKey | BLMKGNGPBNLUQM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|