C22H22ClN — CID 92858642
(2R)-N,N-dibenzyl-2-chloro-2-phenylethanamine (PubChem CID 92858642) has the molecular formula C22H22ClN and a molecular weight of 335.88 g/mol. Its IUPAC name is (2R)-N,N-dibenzyl-2-chloro-2-phenylethanamine.
| Compound Name | (2R)-N,N-dibenzyl-2-chloro-2-phenylethanamine |
|---|---|
| PubChem CID | 92858642 |
| Molecular Formula | C22H22ClN |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (2R)-N,N-dibenzyl-2-chloro-2-phenylethanamine |
| SMILES | Cl[C@@H](CN(Cc1ccccc1)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22ClN/c23-22(21-14-8-3-9-15-21)18-24(16-19-10-4-1-5-11-19)17-20-12-6-2-7-13-20/h1-15,22H,16-18H2/t22-/m0/s1 |
| InChIKey | CZYWRRVFNCAJKT-QFIPXVFZSA-N |
| XLogP | 5.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|