About (3R)-3-phenyloxolane
(3R)-3-phenyloxolane (PubChem CID 92859476) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is (3R)-3-phenyloxolane.
Molecular Properties
| Compound Name | (3R)-3-phenyloxolane |
| PubChem CID | 92859476 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (3R)-3-phenyloxolane |
| SMILES | c1ccc([C@H]2CCOC2)cc1 |
| InChI | InChI=1S/C10H12O/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-5,10H,6-8H2/t10-/m0/s1 |
| InChIKey | CQGVPYYFEIFRKZ-JTQLQIEISA-N |
| XLogP | 2.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-3-phenyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-phenyloxolane?
The IUPAC name of (3R)-3-phenyloxolane (CID 92859476) is (3R)-3-phenyloxolane.
What is the SMILES notation for (3R)-3-phenyloxolane?
The canonical SMILES for (3R)-3-phenyloxolane is c1ccc([C@H]2CCOC2)cc1.
What is the InChIKey of (3R)-3-phenyloxolane?
The InChIKey is CQGVPYYFEIFRKZ-JTQLQIEISA-N. The full InChI is InChI=1S/C10H12O/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-5,10H,6-8H2/t10-/m0/s1.
What are the key properties of (3R)-3-phenyloxolane?
(3R)-3-phenyloxolane has a molecular weight of 148.20 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-phenyloxolane is sourced from PubChem (CID 92859476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).