C12H24O2 — CID 92860075
(4S,6S)-4,6-dibutyl-1,3-dioxane (PubChem CID 92860075) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (4S,6S)-4,6-dibutyl-1,3-dioxane.
| Compound Name | (4S,6S)-4,6-dibutyl-1,3-dioxane |
|---|---|
| PubChem CID | 92860075 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (4S,6S)-4,6-dibutyl-1,3-dioxane |
| SMILES | CCCC[C@H]1C[C@H](CCCC)OCO1 |
| InChI | InChI=1S/C12H24O2/c1-3-5-7-11-9-12(8-6-4-2)14-10-13-11/h11-12H,3-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | UCPAZYFDPOUDHP-RYUDHWBXSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |